![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | burgard-map-1.pdf | 2011-09-22 20:26 | 41M | |
| Dias_thesis.pdf | 2011-09-22 20:22 | 35M | |
| SGP06.pdf | 2011-09-22 20:21 | 12M | |
| Surface Reconstruction from unorganized points.pdf | 2011-09-22 20:23 | 11M | |
| Spectral Surface Reconstruction from Noisy Point Clouds.pdf | 2011-09-22 20:22 | 7.3M | |
| layerpeeling.pdf | 2011-09-22 20:23 | 6.1M | |
| A Flexible New Technique for Camera calibration.pdf | 2011-09-22 20:19 | 5.8M | |
| A Dynamic Surface Reconstruction Framework.pdf | 2011-09-22 20:19 | 4.6M | |
| robust-global-registration.pdf | 2011-09-22 20:23 | 4.2M | |
| THE RECONSTRUCTION OF THE GREAT BUDDHA OF BAMIYAN.pdf | 2011-09-22 20:22 | 3.5M | |
| Dias_CACAIE.pdf | 2011-09-22 20:19 | 2.9M | |
| FROM POINT CLOUD TO SURFACE.pdf | 2011-09-22 20:20 | 2.6M | |
| 3D Reconstruction of Real World Scenes.pdf | 2011-09-22 20:18 | 2.5M | |
| diss.pdf | 2011-09-22 20:22 | 2.5M | |
| Surface reconstruction by layerpeeling.pdf | 2011-09-22 20:22 | 2.0M | |
| ICP.pdf | 2011-09-22 20:20 | 1.9M | |
| ITSCA2010-ATLASCAR_v12b.pdf | 2011-09-22 20:20 | 1.8M | |
| Automatic 3D Reconstruction for Face Recognition.pdf | 2011-09-22 20:19 | 1.8M | |
| ICP Besl.pdf | 2011-09-22 20:20 | 1.6M | |
| SuperCocone.pdf | 2011-09-22 20:22 | 1.3M | |
| 3D Reality Modelling- Photo-Realistic 3D Models of Real World Scenes.pdf | 2011-09-22 20:18 | 1.3M | |
| Dias_2004.pdf | 2011-09-22 20:19 | 1.1M | |
| crust.pdf | 2011-09-22 20:22 | 1.1M | |
| paper_v24b.pdf | 2011-09-22 20:23 | 1.0M | |
| Extrinsic Calibration of a Camera with Dual 2D Laser Range.pdf | 2011-09-22 20:19 | 1.0M | |
| A simple algorithm for homeomorphic surface reconstruction.pdf | 2011-09-22 20:19 | 903K | |
| Multi-Camera_Active_Perception_System_with_Variable_Image_Perspective_for_Mobile_Robot_Navigation.pdf | 2011-09-22 20:20 | 898K | |
| 3D Face Recognition.pdf | 2011-09-22 20:18 | 882K | |
| Rapid Surface Reconstruction from a Point.pdf | 2011-09-22 20:20 | 825K | |
![[ ]](/icons/compressed.gif) | Prediction-based geometric feature extraction for 2D laser scanner.pdf.zip | 2013-09-11 03:04 | 790K | |
| Virtual Reconstruction of Medieval Architecture.pdf | 2011-09-22 20:22 | 754K | |
| 3D Structure from 2D Motion.pdf | 2011-09-22 20:18 | 751K | |
| laser-to-laser.pdf | 2011-09-22 20:23 | 743K | |
| Complete 3D Surface Reconstruction from Unstructured point Cloud.pdf | 2011-09-22 20:19 | 720K | |
| icp-slides.pdf | 2011-09-22 20:23 | 673K | |
| bpa_tvcg.pdf | 2011-09-22 20:22 | 628K | |
| marching triangles.pdf | 2011-09-22 20:23 | 626K | |
| Automatic One Step Extrinsic Calibration of a.pdf | 2011-09-22 20:19 | 625K | |
| SurfaceRecFromCloudOsPoints.pdf | 2011-09-22 20:22 | 558K | |
| A new point cloud simplification algorithm.pdf | 2011-09-22 20:19 | 412K | |
| 10.1.1.138.514.pdf | 2011-09-22 20:18 | 399K | |
| Calibration of Dual Laser-Based Range Cameras.pdf | 2011-09-22 20:19 | 304K | |
| Projective Geometry.pdf | 2011-09-22 20:20 | 295K | |
| A New Voronoi-Based Surface Reconstruction Algorithm.pdf | 2011-09-22 20:19 | 294K | |
| Extrinsic Calibration of a Camera and Laser.pdf | 2011-09-22 20:19 | 260K | |
| Data Fusion Calibration for a 3D Laser Range Finder and a Camera.pdf | 2011-09-22 20:19 | 257K | |
| Bayesian Reconstruction of 3D Human.pdf | 2011-09-22 20:19 | 238K | |
| lecture24.pdf | 2011-09-22 20:23 | 124K | |
|
|---|